C39H45F2NO5 — CID 4171116
ethyl N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate (PubChem CID 4171116) has the molecular formula C39H45F2NO5 and a molecular weight of 645.79 g/mol. Its IUPAC name is ethyl N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate.
| Compound Name | ethyl N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
|---|---|
| PubChem CID | 4171116 |
| Molecular Formula | C39H45F2NO5 |
| Molecular Weight | 645.79 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | ethyl N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C39H45F2NO5/c1-4-47-37(45)42(24-27-10-6-5-7-11-27)25-39(46)20-18-33-31-16-13-28(21-30(43)15-12-26(2)9-8-19-38(33,39)3)22-32(31)36(44)29-14-17-34(40)35(41)23-29/h5-7,9-11,13-14,16-17,22-23,30,33,43,46H,4,8,12,15,18-21,24-25H2,1-3H3 |
| InChIKey | DKVVDEVFJXSHPA-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|