C49H61NO5 — CID 4159895
ethyl N-(1-adamantylmethyl)-N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate (PubChem CID 4159895) has the molecular formula C49H61NO5 and a molecular weight of 744.03 g/mol. Its IUPAC name is ethyl N-(1-adamantylmethyl)-N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate.
| Compound Name | ethyl N-(1-adamantylmethyl)-N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
|---|---|
| PubChem CID | 4159895 |
| Molecular Formula | C49H61NO5 |
| Molecular Weight | 744.03 g/mol |
| Exact Mass | 743.45 |
| IUPAC Name | ethyl N-(1-adamantylmethyl)-N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(CC12CC3CC(CC(C3)C1)C2)CC1(O)CCC2c3ccc(cc3C(=O)c3ccccc3-c3ccccc3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C49H61NO5/c1-4-55-46(53)50(31-48-28-35-23-36(29-48)25-37(24-35)30-48)32-49(54)22-20-44-41-19-17-34(26-39(51)18-16-33(2)11-10-21-47(44,49)3)27-43(41)45(52)42-15-9-8-14-40(42)38-12-6-5-7-13-38/h5-9,11-15,17,19,27,35-37,39,44,51,54H,4,10,16,18,20-26,28-32H2,1-3H3 |
| InChIKey | GVQNSUFAPZDVAM-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.03 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|