C49H53NO5 — CID 4161086
naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate (PubChem CID 4161086) has the molecular formula C49H53NO5 and a molecular weight of 735.97 g/mol. Its IUPAC name is naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate.
| Compound Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 4161086 |
| Molecular Formula | C49H53NO5 |
| Molecular Weight | 735.97 g/mol |
| Exact Mass | 735.39 |
| IUPAC Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccccc3-c3ccccc3)CC(O)CCC(C)=CCCC21C)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C49H53NO5/c1-4-29-50(47(53)55-40-24-22-36-14-8-9-17-38(36)32-40)33-49(54)28-26-45-42-25-21-35(30-39(51)23-20-34(2)13-12-27-48(45,49)3)31-44(42)46(52)43-19-11-10-18-41(43)37-15-6-5-7-16-37/h5-11,13-19,21-22,24-25,31-32,39,45,51,54H,4,12,20,23,26-30,33H2,1-3H3 |
| InChIKey | ZVRXUWDLLGBNRM-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.97 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|