C50H55NO6 — CID 3668871
naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate (PubChem CID 3668871) has the molecular formula C50H55NO6 and a molecular weight of 765.99 g/mol. Its IUPAC name is naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate.
| Compound Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 3668871 |
| Molecular Formula | C50H55NO6 |
| Molecular Weight | 765.99 g/mol |
| Exact Mass | 765.40 |
| IUPAC Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(-c4ccccc4)cc3)CC(O)CCC(C)=CCCC21C)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H55NO6/c1-35-11-9-27-49(2)46(26-28-50(49,55)34-51(29-10-30-56-3)48(54)57-43-24-22-38-14-7-8-15-41(38)33-43)44-25-17-36(31-42(52)23-16-35)32-45(44)47(53)40-20-18-39(19-21-40)37-12-5-4-6-13-37/h4-8,11-15,17-22,24-25,32-33,42,46,52,55H,9-10,16,23,26-31,34H2,1-3H3 |
| InChIKey | WHZWFZIGKVUESX-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.99 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|