C41H52N2O6 — CID 4066363
1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea (PubChem CID 4066363) has the molecular formula C41H52N2O6 and a molecular weight of 668.88 g/mol. Its IUPAC name is 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea.
| Compound Name | 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 4066363 |
| Molecular Formula | C41H52N2O6 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccccc3)CC(O)CCC(C)=CCCC21C)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C41H52N2O6/c1-29-10-8-22-40(2)37(35-20-14-30(26-33(44)17-13-29)27-36(35)38(45)31-11-6-5-7-12-31)21-23-41(40,47)28-43(24-9-25-48-3)39(46)42-32-15-18-34(49-4)19-16-32/h5-7,10-12,14-16,18-20,27,33,37,44,47H,8-9,13,17,21-26,28H2,1-4H3,(H,42,46) |
| InChIKey | IXWMOECFSVYPSJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|