C54H64N2O5 — CID 4576767
1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)urea (PubChem CID 4576767) has the molecular formula C54H64N2O5 and a molecular weight of 821.12 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 4576767 |
| Molecular Formula | C54H64N2O5 |
| Molecular Weight | 821.12 g/mol |
| Exact Mass | 820.48 |
| IUPAC Name | 1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(CC23CC4CC(CC(C4)C2)C3)CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(-c5ccccc5)cc4)CC(O)CCC(C)=CCCC32C)cc1 |
| InChI | InChI=1S/C54H64N2O5/c1-36-8-7-24-52(2)49(47-22-12-37(29-45(57)19-11-36)30-48(47)50(58)43-15-13-42(14-16-43)41-9-5-4-6-10-41)23-25-54(52,60)35-56(51(59)55-44-17-20-46(61-3)21-18-44)34-53-31-38-26-39(32-53)28-40(27-38)33-53/h4-6,8-10,12-18,20-22,30,38-40,45,49,57,60H,7,11,19,23-29,31-35H2,1-3H3,(H,55,59) |
| InChIKey | QBLLMFNBDAZHFV-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.12 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|