C47H56N2O8 — CID 4259824
1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea (PubChem CID 4259824) has the molecular formula C47H56N2O8 and a molecular weight of 776.97 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 4259824 |
| Molecular Formula | C47H56N2O8 |
| Molecular Weight | 776.97 g/mol |
| Exact Mass | 776.40 |
| IUPAC Name | 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccc(OC)cc2OC)CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(OC)cc4)CC(O)CCC(C)=CCCC32C)cc1 |
| InChI | InChI=1S/C47H56N2O8/c1-31-8-7-24-46(2)42(40-22-10-32(26-36(50)16-9-31)27-41(40)44(51)33-11-17-37(54-3)18-12-33)23-25-47(46,53)30-49(29-34-13-19-39(56-5)28-43(34)57-6)45(52)48-35-14-20-38(55-4)21-15-35/h8,10-15,17-22,27-28,36,42,50,53H,7,9,16,23-26,29-30H2,1-6H3,(H,48,52) |
| InChIKey | HOBZHURSYBBQLN-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.97 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|