C46H52F2N2O7 — CID 4101874
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea (PubChem CID 4101874) has the molecular formula C46H52F2N2O7 and a molecular weight of 782.93 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 4101874 |
| Molecular Formula | C46H52F2N2O7 |
| Molecular Weight | 782.93 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccc(OC)cc2OC)CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(F)c(F)c4)CC(O)CCC(C)=CCCC32C)cc1 |
| InChI | InChI=1S/C46H52F2N2O7/c1-29-7-6-21-45(2)39(37-18-9-30(23-34(51)14-8-29)24-38(37)43(52)31-11-19-40(47)41(48)25-31)20-22-46(45,54)28-50(27-32-10-15-36(56-4)26-42(32)57-5)44(53)49-33-12-16-35(55-3)17-13-33/h7,9-13,15-19,24-26,34,39,51,54H,6,8,14,20-23,27-28H2,1-5H3,(H,49,53) |
| InChIKey | OBZPXONLOOHVGJ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.93 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|