C47H56N2O6 — CID 3363294
1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea (PubChem CID 3363294) has the molecular formula C47H56N2O6 and a molecular weight of 744.97 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 3363294 |
| Molecular Formula | C47H56N2O6 |
| Molecular Weight | 744.97 g/mol |
| Exact Mass | 744.41 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(4-methoxyphenyl)-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(-c4ccccc4)cc3)CC(O)CCC(C)=CCCC21C)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C47H56N2O6/c1-33-10-8-26-46(2)43(25-27-47(46,53)32-49(28-9-29-54-3)45(52)48-38-19-22-40(55-4)23-20-38)41-24-14-34(30-39(50)21-13-33)31-42(41)44(51)37-17-15-36(16-18-37)35-11-6-5-7-12-35/h5-7,10-12,14-20,22-24,31,39,43,50,53H,8-9,13,21,25-30,32H2,1-4H3,(H,48,52) |
| InChIKey | DSGGFUCKULUZQS-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.97 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|