C39H49NO3 — CID 6725420
[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone (PubChem CID 6725420) has the molecular formula C39H49NO3 and a molecular weight of 579.83 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone.
| Compound Name | [(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 6725420 |
| Molecular Formula | C39H49NO3 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | [(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone |
| SMILES | CCCN(C)C[C@]1(O)CC[C@H]2c3ccc(cc3C(=O)c3ccc(-c4ccccc4)cc3)C[C@@H](O)CCC(C)=CCC[C@@]21C |
| InChI | InChI=1S/C39H49NO3/c1-5-24-40(4)27-39(43)23-21-36-34-20-14-29(25-33(41)19-13-28(2)10-9-22-38(36,39)3)26-35(34)37(42)32-17-15-31(16-18-32)30-11-7-6-8-12-30/h6-8,10-12,14-18,20,26,33,36,41,43H,5,9,13,19,21-25,27H2,1-4H3/t33-,36-,38-,39+/m0/s1 |
| InChIKey | IBCNHDBSQXZSLF-CRTKTLQZSA-N |
| XLogP | 7.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|