C33H42F3NO4 — CID 6725428
[(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 6725428) has the molecular formula C33H42F3NO4 and a molecular weight of 573.70 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 6725428 |
| Molecular Formula | C33H42F3NO4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | [(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN(C)CCO)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C33H42F3NO4/c1-22-6-5-14-31(2)29(13-15-32(31,41)21-37(3)16-17-38)27-12-10-23(18-26(39)11-9-22)19-28(27)30(40)24-7-4-8-25(20-24)33(34,35)36/h4,6-8,10,12,19-20,26,29,38-39,41H,5,9,11,13-18,21H2,1-3H3/t26-,29-,31-,32+/m0/s1 |
| InChIKey | STNRJCQUVDATBW-OXSAZNSASA-N |
| XLogP | 5.90 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|