C30H41NO5 — CID 6725430
[(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone (PubChem CID 6725430) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone.
| Compound Name | [(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 6725430 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | [(2S,5S,6S,13S)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN(C)CCO)c2ccc(cc2C(=O)c2ccco2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C30H41NO5/c1-21-6-4-13-29(2)26(12-14-30(29,35)20-31(3)15-16-32)24-11-9-22(18-23(33)10-8-21)19-25(24)28(34)27-7-5-17-36-27/h5-7,9,11,17,19,23,26,32-33,35H,4,8,10,12-16,18,20H2,1-3H3/t23-,26-,29-,30+/m0/s1 |
| InChIKey | VLQSQZLUQJGCSQ-MYMNFAFYSA-N |
| XLogP | 4.47 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|