C47H51NO8 — CID 5060561
naphthalen-2-yl N-[(2,4-dimethoxyphenyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate (PubChem CID 5060561) has the molecular formula C47H51NO8 and a molecular weight of 757.92 g/mol. Its IUPAC name is naphthalen-2-yl N-[(2,4-dimethoxyphenyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate.
| Compound Name | naphthalen-2-yl N-[(2,4-dimethoxyphenyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
|---|---|
| PubChem CID | 5060561 |
| Molecular Formula | C47H51NO8 |
| Molecular Weight | 757.92 g/mol |
| Exact Mass | 757.36 |
| IUPAC Name | naphthalen-2-yl N-[(2,4-dimethoxyphenyl)methyl]-N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
| SMILES | COc1ccc(CN(CC2(O)CCC3c4ccc(cc4C(=O)c4ccco4)CC(O)CCC(C)=CCCC32C)C(=O)Oc2ccc3ccccc3c2)c(OC)c1 |
| InChI | InChI=1S/C47H51NO8/c1-31-9-7-22-46(2)41(39-20-14-32(25-36(49)17-13-31)26-40(39)44(50)42-12-8-24-55-42)21-23-47(46,52)30-48(29-35-16-18-37(53-3)28-43(35)54-4)45(51)56-38-19-15-33-10-5-6-11-34(33)27-38/h5-6,8-12,14-16,18-20,24,26-28,36,41,49,52H,7,13,17,21-23,25,29-30H2,1-4H3 |
| InChIKey | BMKNETSJDURISQ-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.92 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|