C37H43NO7 — CID 6728898
(2'S,5S,6'S,13'S)-3-[(2,4-dimethoxyphenyl)methyl]-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one (PubChem CID 6728898) has the molecular formula C37H43NO7 and a molecular weight of 613.75 g/mol. Its IUPAC name is (2'S,5S,6'S,13'S)-3-[(2,4-dimethoxyphenyl)methyl]-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one.
| Compound Name | (2'S,5S,6'S,13'S)-3-[(2,4-dimethoxyphenyl)methyl]-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
|---|---|
| PubChem CID | 6728898 |
| Molecular Formula | C37H43NO7 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | (2'S,5S,6'S,13'S)-3-[(2,4-dimethoxyphenyl)methyl]-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
| SMILES | COc1ccc(CN2C[C@@]3(CC[C@H]4c5ccc(cc5C(=O)c5ccco5)C[C@@H](O)CCC(C)=CCC[C@@]43C)OC2=O)c(OC)c1 |
| InChI | InChI=1S/C37H43NO7/c1-24-7-5-16-36(2)31(29-14-10-25(19-27(39)12-9-24)20-30(29)34(40)32-8-6-18-44-32)15-17-37(36)23-38(35(41)45-37)22-26-11-13-28(42-3)21-33(26)43-4/h6-8,10-11,13-14,18,20-21,27,31,39H,5,9,12,15-17,19,22-23H2,1-4H3/t27-,31-,36-,37+/m0/s1 |
| InChIKey | VIPKTEHSYJIVNF-IHSZVOJWSA-N |
| XLogP | 7.23 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|