C39H48N2O6 — CID 6725634
[(2S,5S,6S,13S)-5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone (PubChem CID 6725634) has the molecular formula C39H48N2O6 and a molecular weight of 640.82 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [(2S,5S,6S,13S)-5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 6725634 |
| Molecular Formula | C39H48N2O6 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | [(2S,5S,6S,13S)-5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc3ccc2[C@@H]2CC[C@@](O)(CN4CCN(C(=O)c5ccco5)CC4)[C@@]2(C)CCC=C(C)CC[C@H](O)C3)cc1 |
| InChI | InChI=1S/C39H48N2O6/c1-27-6-4-17-38(2)34(16-18-39(38,45)26-40-19-21-41(22-20-40)37(44)35-7-5-23-47-35)32-15-9-28(24-30(42)12-8-27)25-33(32)36(43)29-10-13-31(46-3)14-11-29/h5-7,9-11,13-15,23,25,30,34,42,45H,4,8,12,16-22,24,26H2,1-3H3/t30-,34-,38-,39+/m0/s1 |
| InChIKey | GGOGNDCFDHCSFS-HTDVRPCZSA-N |
| XLogP | 6.02 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|