C42H51N3O4 — CID 3363963
8-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 3363963) has the molecular formula C42H51N3O4 and a molecular weight of 661.89 g/mol. Its IUPAC name is 8-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 3363963 |
| Molecular Formula | C42H51N3O4 |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.39 |
| IUPAC Name | 8-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCC3(CC2)C(=O)NCN3c2ccccc2)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C42H51N3O4/c1-30-10-9-20-40(2)37(35-18-16-31(26-34(46)17-15-30)27-36(35)38(47)32-11-5-3-6-12-32)19-21-42(40,49)28-44-24-22-41(23-25-44)39(48)43-29-45(41)33-13-7-4-8-14-33/h3-8,10-14,16,18,27,34,37,46,49H,9,15,17,19-26,28-29H2,1-2H3,(H,43,48) |
| InChIKey | FRFQIXQGUQRYRP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|