C42H49F3N2O5 — CID 4062760
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea (PubChem CID 4062760) has the molecular formula C42H49F3N2O5 and a molecular weight of 718.86 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 4062760 |
| Molecular Formula | C42H49F3N2O5 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C42H49F3N2O5/c1-28-9-7-20-40(2)37(19-21-41(40,51)27-47(26-34-14-8-22-52-34)39(50)46-32-12-4-3-5-13-32)35-18-16-29(23-33(48)17-15-28)24-36(35)38(49)30-10-6-11-31(25-30)42(43,44)45/h3-6,9-13,16,18,24-25,33-34,37,48,51H,7-8,14-15,17,19-23,26-27H2,1-2H3,(H,46,50) |
| InChIKey | LOZABAKSAYUAKB-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|