C41H48F2N2O5 — CID 4062757
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea (PubChem CID 4062757) has the molecular formula C41H48F2N2O5 and a molecular weight of 686.84 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 4062757 |
| Molecular Formula | C41H48F2N2O5 |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-phenylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C41H48F2N2O5/c1-27-8-6-19-40(2)35(18-20-41(40,49)26-45(25-32-11-7-21-50-32)39(48)44-30-9-4-3-5-10-30)33-16-13-28(22-31(46)15-12-27)23-34(33)38(47)29-14-17-36(42)37(43)24-29/h3-5,8-10,13-14,16-17,23-24,31-32,35,46,49H,6-7,11-12,15,18-22,25-26H2,1-2H3,(H,44,48) |
| InChIKey | HHXHLIFQVACUDL-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|