C41H50F2N2O4 — CID 3631749
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea (PubChem CID 3631749) has the molecular formula C41H50F2N2O4 and a molecular weight of 672.86 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea |
|---|---|
| PubChem CID | 3631749 |
| Molecular Formula | C41H50F2N2O4 |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-(1-phenylethyl)-1-propylurea |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C41H50F2N2O4/c1-5-22-45(39(48)44-28(3)30-11-7-6-8-12-30)26-41(49)21-19-35-33-17-14-29(23-32(46)16-13-27(2)10-9-20-40(35,41)4)24-34(33)38(47)31-15-18-36(42)37(43)25-31/h6-8,10-12,14-15,17-18,24-25,28,32,35,46,49H,5,9,13,16,19-23,26H2,1-4H3,(H,44,48) |
| InChIKey | MLNNNCHRMQVOOQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|