C48H57F3N2O4 — CID 4095420
1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea (PubChem CID 4095420) has the molecular formula C48H57F3N2O4 and a molecular weight of 782.99 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea.
| Compound Name | 1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 4095420 |
| Molecular Formula | C48H57F3N2O4 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 1-(1-adamantylmethyl)-1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC23CC4CC(CC(C4)C2)C3)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C48H57F3N2O4/c1-31-8-7-18-45(2)42(40-16-14-32(23-39(54)15-13-31)24-41(40)43(55)36-9-6-10-37(25-36)48(49,50)51)17-19-47(45,57)30-53(44(56)52-38-11-4-3-5-12-38)29-46-26-33-20-34(27-46)22-35(21-33)28-46/h3-6,8-12,14,16,24-25,33-35,39,42,54,57H,7,13,15,17-23,26-30H2,1-2H3,(H,52,56) |
| InChIKey | GAJCIZLLAZRFMJ-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|