C37H46N2O5 — CID 3631742
1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea (PubChem CID 3631742) has the molecular formula C37H46N2O5 and a molecular weight of 598.78 g/mol. Its IUPAC name is 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea.
| Compound Name | 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea |
|---|---|
| PubChem CID | 3631742 |
| Molecular Formula | C37H46N2O5 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-propylurea |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccco3)CC(O)CCC(C)=CCCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C37H46N2O5/c1-4-21-39(35(42)38-28-11-6-5-7-12-28)25-37(43)20-18-32-30-17-15-27(24-31(30)34(41)33-13-9-22-44-33)23-29(40)16-14-26(2)10-8-19-36(32,37)3/h5-7,9-13,15,17,22,24,29,32,40,43H,4,8,14,16,18-21,23,25H2,1-3H3,(H,38,42) |
| InChIKey | WTWCCBNRQUNJTI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|