C34H43NO6S2 — CID 4610233
N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 4610233) has the molecular formula C34H43NO6S2 and a molecular weight of 625.85 g/mol. Its IUPAC name is N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 4610233 |
| Molecular Formula | C34H43NO6S2 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)S(C)(=O)=O)c2ccc(cc2C(=O)c2ccco2)CC(O)CC1 |
| InChI | InChI=1S/C34H43NO6S2/c1-24-7-4-16-33(2)30(14-17-34(33,38)23-35(43(3,39)40)18-15-27-8-6-20-42-27)28-13-11-25(21-26(36)12-10-24)22-29(28)32(37)31-9-5-19-41-31/h5-9,11,13,19-20,22,26,30,36,38H,4,10,12,14-18,21,23H2,1-3H3 |
| InChIKey | WQLZXIDAOCVIGY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|