C39H51NO5S3 — CID 4592525
N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide (PubChem CID 4592525) has the molecular formula C39H51NO5S3 and a molecular weight of 710.04 g/mol. Its IUPAC name is N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide.
| Compound Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4592525 |
| Molecular Formula | C39H51NO5S3 |
| Molecular Weight | 710.04 g/mol |
| Exact Mass | 709.29 |
| IUPAC Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)C2CCCCC2)CC(O)CC1 |
| InChI | InChI=1S/C39H51NO5S3/c1-28-9-6-20-38(2)35(33-17-15-29(25-31(41)16-14-28)26-34(33)37(42)30-10-4-3-5-11-30)18-21-39(38,43)27-40(22-19-32-12-7-23-46-32)48(44,45)36-13-8-24-47-36/h7-9,12-13,15,17,23-24,26,30-31,35,41,43H,3-6,10-11,14,16,18-22,25,27H2,1-2H3 |
| InChIKey | UJPNLAXYVYZJDF-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.04 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|