C41H44F3NO5S2 — CID 4549808
N-benzyl-N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide (PubChem CID 4549808) has the molecular formula C41H44F3NO5S2 and a molecular weight of 751.93 g/mol. Its IUPAC name is N-benzyl-N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-benzyl-N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4549808 |
| Molecular Formula | C41H44F3NO5S2 |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.26 |
| IUPAC Name | N-benzyl-N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccccc2)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C41H44F3NO5S2/c1-28-9-7-20-39(2)36(19-21-40(39,48)27-45(26-29-10-4-3-5-11-29)52(49,50)37-14-8-22-51-37)34-18-16-30(23-33(46)17-15-28)24-35(34)38(47)31-12-6-13-32(25-31)41(42,43)44/h3-6,8-14,16,18,22,24-25,33,36,46,48H,7,15,17,19-21,23,26-27H2,1-2H3 |
| InChIKey | GCSDNKILYBGGIG-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|