C34H39NO5S — CID 4107556
17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one (PubChem CID 4107556) has the molecular formula C34H39NO5S and a molecular weight of 573.76 g/mol. Its IUPAC name is 17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one.
| Compound Name | 17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
|---|---|
| PubChem CID | 4107556 |
| Molecular Formula | C34H39NO5S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethyl-3-(2-thiophen-2-ylethyl)spiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
| SMILES | CC1=CCCC2(C)C(CCC23CN(CCc2cccs2)C(=O)O3)c2ccc(cc2C(=O)c2ccco2)CC(O)CC1 |
| InChI | InChI=1S/C34H39NO5S/c1-23-6-3-15-33(2)29(13-16-34(33)22-35(32(38)40-34)17-14-26-7-5-19-41-26)27-12-10-24(20-25(36)11-9-23)21-28(27)31(37)30-8-4-18-39-30/h4-8,10,12,18-19,21,25,29,36H,3,9,11,13-17,20,22H2,1-2H3 |
| InChIKey | YKZSAWLSSDIYDP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|