C35H39NO5 — CID 4999643
3-benzyl-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one (PubChem CID 4999643) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-benzyl-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one.
| Compound Name | 3-benzyl-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
|---|---|
| PubChem CID | 4999643 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 3-benzyl-17'-(furan-2-carbonyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
| SMILES | CC1=CCCC2(C)C(CCC23CN(Cc2ccccc2)C(=O)O3)c2ccc(cc2C(=O)c2ccco2)CC(O)CC1 |
| InChI | InChI=1S/C35H39NO5/c1-24-8-6-17-34(2)30(16-18-35(34)23-36(33(39)41-35)22-25-9-4-3-5-10-25)28-15-13-26(20-27(37)14-12-24)21-29(28)32(38)31-11-7-19-40-31/h3-5,7-11,13,15,19,21,27,30,37H,6,12,14,16-18,20,22-23H2,1-2H3 |
| InChIKey | MTFSZDCQOJYVGK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|