C37H39F2NO4 — CID 4081850
3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one (PubChem CID 4081850) has the molecular formula C37H39F2NO4 and a molecular weight of 599.72 g/mol. Its IUPAC name is 3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one.
| Compound Name | 3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
|---|---|
| PubChem CID | 4081850 |
| Molecular Formula | C37H39F2NO4 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | 3-benzyl-17'-(3,4-difluorobenzoyl)-13'-hydroxy-6',10'-dimethylspiro[1,3-oxazolidine-5,5'-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene]-2-one |
| SMILES | CC1=CCCC2(C)C(CCC23CN(Cc2ccccc2)C(=O)O3)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C37H39F2NO4/c1-24-7-6-17-36(2)31(16-18-37(36)23-40(35(43)44-37)22-25-8-4-3-5-9-25)29-14-11-26(19-28(41)13-10-24)20-30(29)34(42)27-12-15-32(38)33(39)21-27/h3-5,7-9,11-12,14-15,20-21,28,31,41H,6,10,13,16-19,22-23H2,1-2H3 |
| InChIKey | UFAGSZONBRCXER-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|