C37H48N2O5S — CID 6728592
1-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 6728592) has the molecular formula C37H48N2O5S and a molecular weight of 632.87 g/mol. Its IUPAC name is 1-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 6728592 |
| Molecular Formula | C37H48N2O5S |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | 1-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN(CCc2cccs2)C(=O)NC(C)C)c2ccc(cc2C(=O)c2ccco2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C37H48N2O5S/c1-25(2)38-35(42)39(19-16-29-9-7-21-45-29)24-37(43)18-15-32-30-14-12-27(23-31(30)34(41)33-10-6-20-44-33)22-28(40)13-11-26(3)8-5-17-36(32,37)4/h6-10,12,14,20-21,23,25,28,32,40,43H,5,11,13,15-19,22,24H2,1-4H3,(H,38,42)/t28-,32-,36-,37+/m0/s1 |
| InChIKey | AGFIAEOTJUBPOT-JUISLTCFSA-N |
| XLogP | 7.27 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|