C46H49NO5S — CID 4173533
naphthalen-2-yl N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 4173533) has the molecular formula C46H49NO5S and a molecular weight of 727.97 g/mol. Its IUPAC name is naphthalen-2-yl N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | naphthalen-2-yl N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 4173533 |
| Molecular Formula | C46H49NO5S |
| Molecular Weight | 727.97 g/mol |
| Exact Mass | 727.33 |
| IUPAC Name | naphthalen-2-yl N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)Oc2ccc3ccccc3c2)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C46H49NO5S/c1-32-10-8-24-45(2)42(40-21-17-33(28-37(48)19-16-32)29-41(40)43(49)35-12-4-3-5-13-35)22-25-46(45,51)31-47(26-23-39-15-9-27-53-39)44(50)52-38-20-18-34-11-6-7-14-36(34)30-38/h3-7,9-15,17-18,20-21,27,29-30,37,42,48,51H,8,16,19,22-26,28,31H2,1-2H3 |
| InChIKey | IVKVLCYDSVJIQP-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.97 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|