C46H61NO5S — CID 5072943
(5-methyl-2-propan-2-ylcyclohexyl) N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 5072943) has the molecular formula C46H61NO5S and a molecular weight of 740.06 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 5072943 |
| Molecular Formula | C46H61NO5S |
| Molecular Weight | 740.06 g/mol |
| Exact Mass | 739.43 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)OC2CC(C)CCC2C(C)C)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C46H61NO5S/c1-31(2)38-19-16-33(4)27-42(38)52-44(50)47(25-22-37-14-10-26-53-37)30-46(51)24-21-41-39-20-17-34(29-40(39)43(49)35-12-7-6-8-13-35)28-36(48)18-15-32(3)11-9-23-45(41,46)5/h6-8,10-14,17,20,26,29,31,33,36,38,41-42,48,51H,9,15-16,18-19,21-25,27-28,30H2,1-5H3 |
| InChIKey | IZLPCBVLGZHYBC-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.06 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|