C51H55NO6 — CID 4582286
naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)carbamate (PubChem CID 4582286) has the molecular formula C51H55NO6 and a molecular weight of 778.00 g/mol. Its IUPAC name is naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)carbamate.
| Compound Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 4582286 |
| Molecular Formula | C51H55NO6 |
| Molecular Weight | 778.00 g/mol |
| Exact Mass | 777.40 |
| IUPAC Name | naphthalen-2-yl N-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)C(=O)Oc2ccc3ccccc3c2)c2ccc(cc2C(=O)c2ccccc2-c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C51H55NO6/c1-35-12-10-27-50(2)47(26-28-51(50,56)34-52(33-42-17-11-29-57-42)49(55)58-41-24-22-37-13-6-7-16-39(37)32-41)44-25-21-36(30-40(53)23-20-35)31-46(44)48(54)45-19-9-8-18-43(45)38-14-4-3-5-15-38/h3-9,12-16,18-19,21-22,24-25,31-32,40,42,47,53,56H,10-11,17,20,23,26-30,33-34H2,1-2H3 |
| InChIKey | ATNMNISYCPKYCV-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.00 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|