C39H53NO6S — CID 6727563
N-(1-adamantylmethyl)-N-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide (PubChem CID 6727563) has the molecular formula C39H53NO6S and a molecular weight of 663.92 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide.
| Compound Name | N-(1-adamantylmethyl)-N-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 6727563 |
| Molecular Formula | C39H53NO6S |
| Molecular Weight | 663.92 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[[(2S,5S,6S,13S)-17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]methanesulfonamide |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN(CC23CC4CC(CC(C4)C2)C3)S(C)(=O)=O)c2ccc(cc2C(=O)c2ccco2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C39H53NO6S/c1-26-6-4-13-37(2)34(32-11-9-27(19-31(41)10-8-26)20-33(32)36(42)35-7-5-15-46-35)12-14-39(37,43)25-40(47(3,44)45)24-38-21-28-16-29(22-38)18-30(17-28)23-38/h5-7,9,11,15,20,28-31,34,41,43H,4,8,10,12-14,16-19,21-25H2,1-3H3/t28?,29?,30?,31-,34-,37-,38?,39+/m0/s1 |
| InChIKey | JTVUNZNFOAEPAT-WMLJNNLNSA-N |
| XLogP | 7.03 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.92 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|