C45H57NO5S — CID 3699973
ethyl N-(1-adamantylmethyl)-N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate (PubChem CID 3699973) has the molecular formula C45H57NO5S and a molecular weight of 724.02 g/mol. Its IUPAC name is ethyl N-(1-adamantylmethyl)-N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate.
| Compound Name | ethyl N-(1-adamantylmethyl)-N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3699973 |
| Molecular Formula | C45H57NO5S |
| Molecular Weight | 724.02 g/mol |
| Exact Mass | 723.40 |
| IUPAC Name | ethyl N-(1-adamantylmethyl)-N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(CC12CC3CC(CC(C3)C1)C2)CC1(O)CCC2c3ccc(cc3C(=O)c3cc4ccccc4s3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C45H57NO5S/c1-4-51-42(49)46(27-44-24-31-18-32(25-44)20-33(19-31)26-44)28-45(50)17-15-38-36-14-12-30(21-35(47)13-11-29(2)8-7-16-43(38,45)3)22-37(36)41(48)40-23-34-9-5-6-10-39(34)52-40/h5-6,8-10,12,14,22-23,31-33,35,38,47,50H,4,7,11,13,15-21,24-28H2,1-3H3 |
| InChIKey | ACQDGIIRWSTZDK-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.02 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|