C44H57NO5S — CID 3427973
ethyl N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate (PubChem CID 3427973) has the molecular formula C44H57NO5S and a molecular weight of 712.01 g/mol. Its IUPAC name is ethyl N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate.
| Compound Name | ethyl N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
|---|---|
| PubChem CID | 3427973 |
| Molecular Formula | C44H57NO5S |
| Molecular Weight | 712.01 g/mol |
| Exact Mass | 711.40 |
| IUPAC Name | ethyl N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
| SMILES | CCOC(=O)N(CC1CCC2CC1C2(C)C)CC1(O)CCC2c3ccc(cc3C(=O)c3cc4ccccc4s3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C44H57NO5S/c1-6-50-41(48)45(26-31-15-16-32-25-37(31)42(32,3)4)27-44(49)21-19-36-34-18-14-29(22-33(46)17-13-28(2)10-9-20-43(36,44)5)23-35(34)40(47)39-24-30-11-7-8-12-38(30)51-39/h7-8,10-12,14,18,23-24,31-33,36-37,46,49H,6,9,13,15-17,19-22,25-27H2,1-5H3 |
| InChIKey | ANSXPCFHGMVZCI-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.01 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|