C48H61NO5 — CID 4301768
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate (PubChem CID 4301768) has the molecular formula C48H61NO5 and a molecular weight of 732.02 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
|---|---|
| PubChem CID | 4301768 |
| Molecular Formula | C48H61NO5 |
| Molecular Weight | 732.02 g/mol |
| Exact Mass | 731.45 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
| SMILES | CCOC(=O)N(CC1CCC2CC1C2(C)C)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(-c4ccccc4)cc3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C48H61NO5/c1-6-54-45(52)49(30-37-20-21-38-29-43(37)46(38,3)4)31-48(53)26-24-42-40-23-15-33(27-39(50)22-14-32(2)11-10-25-47(42,48)5)28-41(40)44(51)36-18-16-35(17-19-36)34-12-8-7-9-13-34/h7-9,11-13,15-19,23,28,37-39,42-43,50,53H,6,10,14,20-22,24-27,29-31H2,1-5H3 |
| InChIKey | HDUBWZJDZSLNIY-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.02 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|