C38H39NO3S3 — CID 5058767
[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(1-benzothiophen-2-yl)methanone (PubChem CID 5058767) has the molecular formula C38H39NO3S3 and a molecular weight of 653.94 g/mol. Its IUPAC name is [5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(1-benzothiophen-2-yl)methanone.
| Compound Name | [5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 5058767 |
| Molecular Formula | C38H39NO3S3 |
| Molecular Weight | 653.94 g/mol |
| Exact Mass | 653.21 |
| IUPAC Name | [5-(1,3-benzothiazol-2-ylsulfanylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(1-benzothiophen-2-yl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CSc2nc3ccccc3s2)c2ccc(cc2C(=O)c2cc3ccccc3s2)CC(O)CC1 |
| InChI | InChI=1S/C38H39NO3S3/c1-24-8-7-18-37(2)30(17-19-38(37,42)23-43-36-39-31-10-4-6-12-33(31)45-36)28-16-14-25(20-27(40)15-13-24)21-29(28)35(41)34-22-26-9-3-5-11-32(26)44-34/h3-6,8-12,14,16,21-22,27,30,40,42H,7,13,15,17-20,23H2,1-2H3 |
| InChIKey | QJPWUOCXPYZEFI-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.94 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|