C40H49NO5S2 — CID 3352063
1-benzothiophen-2-yl-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 3352063) has the molecular formula C40H49NO5S2 and a molecular weight of 687.97 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 3352063 |
| Molecular Formula | C40H49NO5S2 |
| Molecular Weight | 687.97 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | 1-benzothiophen-2-yl-[5-[[2,3-dihydroxypropyl(2-thiophen-2-ylethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)CC(O)CO)c2ccc(cc2C(=O)c2cc3ccccc3s2)CC(O)CC1 |
| InChI | InChI=1S/C40H49NO5S2/c1-27-7-5-17-39(2)35(15-18-40(39,46)26-41(24-31(44)25-42)19-16-32-9-6-20-47-32)33-14-12-28(21-30(43)13-11-27)22-34(33)38(45)37-23-29-8-3-4-10-36(29)48-37/h3-4,6-10,12,14,20,22-23,30-31,35,42-44,46H,5,11,13,15-19,21,24-26H2,1-2H3 |
| InChIKey | NSFJHPMUESHVDF-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.97 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|