C39H49NO5 — CID 6728036
[(2S,5S,6S,13S)-5-[[benzyl-[(2S)-2,3-dihydroxypropyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone (PubChem CID 6728036) has the molecular formula C39H49NO5 and a molecular weight of 611.82 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5-[[benzyl-[(2S)-2,3-dihydroxypropyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone.
| Compound Name | [(2S,5S,6S,13S)-5-[[benzyl-[(2S)-2,3-dihydroxypropyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone |
|---|---|
| PubChem CID | 6728036 |
| Molecular Formula | C39H49NO5 |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | [(2S,5S,6S,13S)-5-[[benzyl-[(2S)-2,3-dihydroxypropyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-phenylmethanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN(Cc2ccccc2)C[C@H](O)CO)c2ccc(cc2C(=O)c2ccccc2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C39H49NO5/c1-28-10-9-20-38(2)36(19-21-39(38,45)27-40(25-33(43)26-41)24-29-11-5-3-6-12-29)34-18-16-30(22-32(42)17-15-28)23-35(34)37(44)31-13-7-4-8-14-31/h3-8,10-14,16,18,23,32-33,36,41-43,45H,9,15,17,19-22,24-27H2,1-2H3/t32-,33-,36-,38-,39+/m0/s1 |
| InChIKey | GVXNRSBCIGCMTB-FYZWRCCISA-N |
| XLogP | 5.81 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|