C44H51NO3 — CID 3590028
[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone (PubChem CID 3590028) has the molecular formula C44H51NO3 and a molecular weight of 641.90 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 3590028 |
| Molecular Formula | C44H51NO3 |
| Molecular Weight | 641.90 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-[[methyl(2-phenylethyl)amino]methyl]-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(C)CCc2ccccc2)c2ccc(cc2C(=O)c2ccc(-c3ccccc3)cc2)CC(O)CC1 |
| InChI | InChI=1S/C44H51NO3/c1-32-11-10-26-43(2)41(24-27-44(43,48)31-45(3)28-25-33-12-6-4-7-13-33)39-23-17-34(29-38(46)22-16-32)30-40(39)42(47)37-20-18-36(19-21-37)35-14-8-5-9-15-35/h4-9,11-15,17-21,23,30,38,41,46,48H,10,16,22,24-29,31H2,1-3H3 |
| InChIKey | LMGBBVZZJVWHJF-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.90 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|