C47H51NO5S — CID 3416460
N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide (PubChem CID 3416460) has the molecular formula C47H51NO5S and a molecular weight of 741.99 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 3416460 |
| Molecular Formula | C47H51NO5S |
| Molecular Weight | 741.99 g/mol |
| Exact Mass | 741.35 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2cccc3ccccc23)S(C)(=O)=O)c2ccc(cc2C(=O)c2ccc(-c3ccccc3)cc2)CC(O)CC1 |
| InChI | InChI=1S/C47H51NO5S/c1-33-11-10-27-46(2)44(26-28-47(46,51)32-48(54(3,52)53)31-39-16-9-15-37-14-7-8-17-41(37)39)42-25-19-34(29-40(49)24-18-33)30-43(42)45(50)38-22-20-36(21-23-38)35-12-5-4-6-13-35/h4-9,11-17,19-23,25,30,40,44,49,51H,10,18,24,26-29,31-32H2,1-3H3 |
| InChIKey | YUKWJHHIKDHBFO-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.99 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|