C40H53NO7S — CID 4623877
[5-[[2,3-dihydroxypropyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone (PubChem CID 4623877) has the molecular formula C40H53NO7S and a molecular weight of 691.93 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 4623877 |
| Molecular Formula | C40H53NO7S |
| Molecular Weight | 691.93 g/mol |
| Exact Mass | 691.35 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl-[(2,4-dimethoxyphenyl)methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
| SMILES | COc1ccc(CN(CC(O)CO)CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(C)s4)CC(O)CCC(C)=CCCC32C)c(OC)c1 |
| InChI | InChI=1S/C40H53NO7S/c1-26-7-6-17-39(3)35(33-14-10-28(19-30(43)12-8-26)20-34(33)38(45)37-15-9-27(2)49-37)16-18-40(39,46)25-41(23-31(44)24-42)22-29-11-13-32(47-4)21-36(29)48-5/h7,9-11,13-15,20-21,30-31,35,42-44,46H,6,8,12,16-19,22-25H2,1-5H3 |
| InChIKey | VQHKXGMBXBNGQZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.93 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|