C34H48N2O4S — CID 3421258
[5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone (PubChem CID 3421258) has the molecular formula C34H48N2O4S and a molecular weight of 580.84 g/mol. Its IUPAC name is [5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 3421258 |
| Molecular Formula | C34H48N2O4S |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | [5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCN(CCO)CC2)c2ccc(cc2C(=O)c2ccc(C)s2)CC(O)CC1 |
| InChI | InChI=1S/C34H48N2O4S/c1-24-5-4-13-33(3)30(12-14-34(33,40)23-36-17-15-35(16-18-36)19-20-37)28-10-8-26(21-27(38)9-6-24)22-29(28)32(39)31-11-7-25(2)41-31/h5,7-8,10-11,22,27,30,37-38,40H,4,6,9,12-21,23H2,1-3H3 |
| InChIKey | FJUFTOBHOSTPKP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|