C37H44F3NO5S2 — CID 4112088
N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 4112088) has the molecular formula C37H44F3NO5S2 and a molecular weight of 703.89 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 4112088 |
| Molecular Formula | C37H44F3NO5S2 |
| Molecular Weight | 703.89 g/mol |
| Exact Mass | 703.26 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)S(C)(=O)=O)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C37H44F3NO5S2/c1-25-7-5-17-35(2)33(15-18-36(35,44)24-41(48(3,45)46)19-16-30-10-6-20-47-30)31-14-12-26(21-29(42)13-11-25)22-32(31)34(43)27-8-4-9-28(23-27)37(38,39)40/h4,6-10,12,14,20,22-23,29,33,42,44H,5,11,13,15-19,21,24H2,1-3H3 |
| InChIKey | UUHZIBCDEGRUTL-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.89 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|