C38H46F3NO6S2 — CID 4171576
N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide (PubChem CID 4171576) has the molecular formula C38H46F3NO6S2 and a molecular weight of 733.92 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4171576 |
| Molecular Formula | C38H46F3NO6S2 |
| Molecular Weight | 733.92 g/mol |
| Exact Mass | 733.27 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC(C)=CCCC21C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C38H46F3NO6S2/c1-26-8-5-17-36(2)33(16-18-37(36,45)25-42(19-7-20-48-3)50(46,47)34-11-6-21-49-34)31-15-13-27(22-30(43)14-12-26)23-32(31)35(44)28-9-4-10-29(24-28)38(39,40)41/h4,6,8-11,13,15,21,23-24,30,33,43,45H,5,7,12,14,16-20,22,25H2,1-3H3 |
| InChIKey | AFPPCYQJHIKNBR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.92 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|