C38H47FN2O3S — CID 3701573
[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone (PubChem CID 3701573) has the molecular formula C38H47FN2O3S and a molecular weight of 630.87 g/mol. Its IUPAC name is [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 3701573 |
| Molecular Formula | C38H47FN2O3S |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCN(c3ccc(F)cc3)CC2)c2ccc(cc2C(=O)c2ccc(C)s2)CC(O)CC1 |
| InChI | InChI=1S/C38H47FN2O3S/c1-26-5-4-17-37(3)34(16-18-38(37,44)25-40-19-21-41(22-20-40)30-11-9-29(39)10-12-30)32-14-8-28(23-31(42)13-6-26)24-33(32)36(43)35-15-7-27(2)45-35/h5,7-12,14-15,24,31,34,42,44H,4,6,13,16-23,25H2,1-3H3 |
| InChIKey | KEQOCTUVLOWTKH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|