C41H47FN2O3S — CID 4674367
1-benzothiophen-2-yl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4674367) has the molecular formula C41H47FN2O3S and a molecular weight of 666.90 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4674367 |
| Molecular Formula | C41H47FN2O3S |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | 1-benzothiophen-2-yl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cc5ccccc5s4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C41H47FN2O3S/c1-37-14-11-30(45)24-39(37)17-18-41(31(25-39)36(46)33-23-27-5-3-4-6-32(27)48-33)34(37)12-15-38(2)35(41)13-16-40(38,47)26-43-19-21-44(22-20-43)29-9-7-28(42)8-10-29/h3-10,17-18,23,25,30,34-35,45,47H,11-16,19-22,24,26H2,1-2H3 |
| InChIKey | CFFBRALHSBLYEH-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|