C42H46F2N2O4S — CID 4294413
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 4294413) has the molecular formula C42H46F2N2O4S and a molecular weight of 712.90 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 4294413 |
| Molecular Formula | C42H46F2N2O4S |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.31 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(CCc1cccs1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C42H46F2N2O4S/c1-38-16-12-29(47)24-40(38)19-20-42(31(25-40)36(48)27-10-11-32(43)33(44)23-27)34(38)13-17-39(2)35(42)14-18-41(39,50)26-46(21-15-30-9-6-22-51-30)37(49)45-28-7-4-3-5-8-28/h3-11,19-20,22-23,25,29,34-35,47,50H,12-18,21,24,26H2,1-2H3,(H,45,49) |
| InChIKey | URZSSPMISKTTLZ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|