C39H48F2N2O4S — CID 4159271
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 4159271) has the molecular formula C39H48F2N2O4S and a molecular weight of 678.89 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 4159271 |
| Molecular Formula | C39H48F2N2O4S |
| Molecular Weight | 678.89 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC(C)NC(=O)N(CCc1cccs1)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(F)c(F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C39H48F2N2O4S/c1-24(2)42-34(46)43(18-12-27-6-5-19-48-27)23-38(47)15-11-32-36(38,4)14-10-31-35(3)13-9-26(44)21-37(35)16-17-39(31,32)28(22-37)33(45)25-7-8-29(40)30(41)20-25/h5-8,16-17,19-20,22,24,26,31-32,44,47H,9-15,18,21,23H2,1-4H3,(H,42,46) |
| InChIKey | XSYHFTNEDRJPFX-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.89 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|