C43H47F3N2O4S — CID 4195285
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 4195285) has the molecular formula C43H47F3N2O4S and a molecular weight of 744.92 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 4195285 |
| Molecular Formula | C43H47F3N2O4S |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 744.32 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-phenyl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)Nc2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C43H47F3N2O4S/c1-29-9-7-21-41(2)38(19-22-42(41,52)28-48(23-20-35-14-8-24-53-35)40(51)47-33-12-4-3-5-13-33)36-18-16-30(25-34(49)17-15-29)26-37(36)39(50)31-10-6-11-32(27-31)43(44,45)46/h3-6,8-14,16,18,24,26-27,34,38,49,52H,7,15,17,19-23,25,28H2,1-2H3,(H,47,51) |
| InChIKey | CMUTWVMMEWALHZ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|