C39H53FN2O3 — CID 4187577
cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 4187577) has the molecular formula C39H53FN2O3 and a molecular weight of 616.86 g/mol. Its IUPAC name is cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 4187577 |
| Molecular Formula | C39H53FN2O3 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCN(c3ccc(F)cc3)CC2)c2ccc(cc2C(=O)C2CCCCC2)CC(O)CC1 |
| InChI | InChI=1S/C39H53FN2O3/c1-28-7-6-19-38(2)36(18-20-39(38,45)27-41-21-23-42(24-22-41)32-14-12-31(40)13-15-32)34-17-11-29(25-33(43)16-10-28)26-35(34)37(44)30-8-4-3-5-9-30/h7,11-15,17,26,30,33,36,43,45H,3-6,8-10,16,18-25,27H2,1-2H3 |
| InChIKey | NDFXCIPRKWNMLZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|